C18H16F2N4O2 — CID 129116287
5-fluoro-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]quinazoline-4,7-diamine (PubChem CID 129116287) has the molecular formula C18H16F2N4O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-fluoro-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]quinazoline-4,7-diamine.
| Compound Name | 5-fluoro-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 129116287 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-fluoro-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]quinazoline-4,7-diamine |
| SMILES | Nc1cc(F)c2c(Nc3ccc(F)cc3OC3CCOC3)ncnc2c1 |
| InChI | InChI=1S/C18H16F2N4O2/c19-10-1-2-14(16(5-10)26-12-3-4-25-8-12)24-18-17-13(20)6-11(21)7-15(17)22-9-23-18/h1-2,5-7,9,12H,3-4,8,21H2,(H,22,23,24) |
| InChIKey | MEZZWPNHZWNUAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|