C23H31FN4O2S — CID 144623004
4-N-(2-cyclohexyloxy-4-fluorophenyl)-5-methylquinazoline-4,7-diamine;methanethiol;methanol (PubChem CID 144623004) has the molecular formula C23H31FN4O2S and a molecular weight of 446.59 g/mol. Its IUPAC name is 4-N-(2-cyclohexyloxy-4-fluorophenyl)-5-methylquinazoline-4,7-diamine;methanethiol;methanol.
| Compound Name | 4-N-(2-cyclohexyloxy-4-fluorophenyl)-5-methylquinazoline-4,7-diamine;methanethiol;methanol |
|---|---|
| PubChem CID | 144623004 |
| Molecular Formula | C23H31FN4O2S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 4-N-(2-cyclohexyloxy-4-fluorophenyl)-5-methylquinazoline-4,7-diamine;methanethiol;methanol |
| SMILES | CO.CS.Cc1cc(N)cc2ncnc(Nc3ccc(F)cc3OC3CCCCC3)c12 |
| InChI | InChI=1S/C21H23FN4O.CH4O.CH4S/c1-13-9-15(23)11-18-20(13)21(25-12-24-18)26-17-8-7-14(22)10-19(17)27-16-5-3-2-4-6-16;2*1-2/h7-12,16H,2-6,23H2,1H3,(H,24,25,26);2*2H,1H3 |
| InChIKey | VELYYFAQUNWKIU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|