C22H26FN5O2 — CID 129116403
2-[(3R)-3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]piperidin-1-yl]ethanol (PubChem CID 129116403) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[(3R)-3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]piperidin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 129116403 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-[(3R)-3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]piperidin-1-yl]ethanol |
| SMILES | Cc1cc(N)cc2ncnc(Nc3ccc(F)cc3O[C@@H]3CCCN(CCO)C3)c12 |
| InChI | InChI=1S/C22H26FN5O2/c1-14-9-16(24)11-19-21(14)22(26-13-25-19)27-18-5-4-15(23)10-20(18)30-17-3-2-6-28(12-17)7-8-29/h4-5,9-11,13,17,29H,2-3,6-8,12,24H2,1H3,(H,25,26,27)/t17-/m1/s1 |
| InChIKey | ZEMGGBHKLPGCKN-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|