C20H22FN5OS — CID 144622975
4-N-[4-fluoro-2-(1-methylsulfanylpyrrolidin-3-yl)oxyphenyl]-5-methylquinazoline-4,7-diamine (PubChem CID 144622975) has the molecular formula C20H22FN5OS and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-N-[4-fluoro-2-(1-methylsulfanylpyrrolidin-3-yl)oxyphenyl]-5-methylquinazoline-4,7-diamine.
| Compound Name | 4-N-[4-fluoro-2-(1-methylsulfanylpyrrolidin-3-yl)oxyphenyl]-5-methylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 144622975 |
| Molecular Formula | C20H22FN5OS |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-N-[4-fluoro-2-(1-methylsulfanylpyrrolidin-3-yl)oxyphenyl]-5-methylquinazoline-4,7-diamine |
| SMILES | CSN1CCC(Oc2cc(F)ccc2Nc2ncnc3cc(N)cc(C)c23)C1 |
| InChI | InChI=1S/C20H22FN5OS/c1-12-7-14(22)9-17-19(12)20(24-11-23-17)25-16-4-3-13(21)8-18(16)27-15-5-6-26(10-15)28-2/h3-4,7-9,11,15H,5-6,10,22H2,1-2H3,(H,23,24,25) |
| InChIKey | ZFWRATXDVPVGQO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|