C21H24F2N4O2S — CID 144622942
4-[2-[(7-amino-5-fluoroquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methanethiol (PubChem CID 144622942) has the molecular formula C21H24F2N4O2S and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-[2-[(7-amino-5-fluoroquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methanethiol.
| Compound Name | 4-[2-[(7-amino-5-fluoroquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methanethiol |
|---|---|
| PubChem CID | 144622942 |
| Molecular Formula | C21H24F2N4O2S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[2-[(7-amino-5-fluoroquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methanethiol |
| SMILES | CS.Nc1cc(F)c2c(Nc3ccc(F)cc3OC3CCC(O)CC3)ncnc2c1 |
| InChI | InChI=1S/C20H20F2N4O2.CH4S/c21-11-1-6-16(18(7-11)28-14-4-2-13(27)3-5-14)26-20-19-15(22)8-12(23)9-17(19)24-10-25-20;1-2/h1,6-10,13-14,27H,2-5,23H2,(H,24,25,26);2H,1H3 |
| InChIKey | FDGIYSGVPSUJGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|