C23H29FN4O2S — CID 144623003
2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methylsulfanylmethane (PubChem CID 144623003) has the molecular formula C23H29FN4O2S and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methylsulfanylmethane.
| Compound Name | 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methylsulfanylmethane |
|---|---|
| PubChem CID | 144623003 |
| Molecular Formula | C23H29FN4O2S |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]cyclohexan-1-ol;methylsulfanylmethane |
| SMILES | CSC.Cc1cc(N)cc2ncnc(Nc3ccc(F)cc3OC3CCCCC3O)c12 |
| InChI | InChI=1S/C21H23FN4O2.C2H6S/c1-12-8-14(23)10-16-20(12)21(25-11-24-16)26-15-7-6-13(22)9-19(15)28-18-5-3-2-4-17(18)27;1-3-2/h6-11,17-18,27H,2-5,23H2,1H3,(H,24,25,26);1-2H3 |
| InChIKey | KJAQCJUMMDNIHT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|