C23H33N5O2S — CID 144622947
4-N-(2-cyclohexyloxy-3-pyridinyl)-5-methylquinazoline-4,7-diamine;methanol;methylsulfanylmethane (PubChem CID 144622947) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 4-N-(2-cyclohexyloxy-3-pyridinyl)-5-methylquinazoline-4,7-diamine;methanol;methylsulfanylmethane.
| Compound Name | 4-N-(2-cyclohexyloxy-3-pyridinyl)-5-methylquinazoline-4,7-diamine;methanol;methylsulfanylmethane |
|---|---|
| PubChem CID | 144622947 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 4-N-(2-cyclohexyloxy-3-pyridinyl)-5-methylquinazoline-4,7-diamine;methanol;methylsulfanylmethane |
| SMILES | CO.CSC.Cc1cc(N)cc2ncnc(Nc3cccnc3OC3CCCCC3)c12 |
| InChI | InChI=1S/C20H23N5O.C2H6S.CH4O/c1-13-10-14(21)11-17-18(13)19(24-12-23-17)25-16-8-5-9-22-20(16)26-15-6-3-2-4-7-15;1-3-2;1-2/h5,8-12,15H,2-4,6-7,21H2,1H3,(H,23,24,25);1-2H3;2H,1H3 |
| InChIKey | ZCLDEKHFVUENOS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|