C22H25FN4O2 — CID 129116341
4-N-[4-fluoro-2-(3-methoxycyclohexyl)oxyphenyl]-5-methylquinazoline-4,7-diamine (PubChem CID 129116341) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-N-[4-fluoro-2-(3-methoxycyclohexyl)oxyphenyl]-5-methylquinazoline-4,7-diamine.
| Compound Name | 4-N-[4-fluoro-2-(3-methoxycyclohexyl)oxyphenyl]-5-methylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 129116341 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-N-[4-fluoro-2-(3-methoxycyclohexyl)oxyphenyl]-5-methylquinazoline-4,7-diamine |
| SMILES | COC1CCCC(Oc2cc(F)ccc2Nc2ncnc3cc(N)cc(C)c23)C1 |
| InChI | InChI=1S/C22H25FN4O2/c1-13-8-15(24)10-19-21(13)22(26-12-25-19)27-18-7-6-14(23)9-20(18)29-17-5-3-4-16(11-17)28-2/h6-10,12,16-17H,3-5,11,24H2,1-2H3,(H,25,26,27) |
| InChIKey | AKSZWBODUQTIGS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|