C19H17FN4O3 — CID 129117380
3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]oxolan-2-one (PubChem CID 129117380) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is 3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]oxolan-2-one.
| Compound Name | 3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]oxolan-2-one |
|---|---|
| PubChem CID | 129117380 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]oxolan-2-one |
| SMILES | Cc1cc(N)cc2ncnc(Nc3ccc(F)cc3OC3CCOC3=O)c12 |
| InChI | InChI=1S/C19H17FN4O3/c1-10-6-12(21)8-14-17(10)18(23-9-22-14)24-13-3-2-11(20)7-16(13)27-15-4-5-26-19(15)25/h2-3,6-9,15H,4-5,21H2,1H3,(H,22,23,24) |
| InChIKey | QYWGHMSUYDPBOU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|