C21H21FN4O4S — CID 123946237
3-[5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenoxy]oxolan-2-one (PubChem CID 123946237) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenoxy]oxolan-2-one.
| Compound Name | 3-[5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenoxy]oxolan-2-one |
|---|---|
| PubChem CID | 123946237 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-[5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenoxy]oxolan-2-one |
| SMILES | C=S(C)(=O)Nc1cc(C)c2c(Nc3ccc(F)cc3OC3CCOC3=O)ncnc2c1 |
| InChI | InChI=1S/C21H21FN4O4S/c1-12-8-14(26-31(2,3)28)10-16-19(12)20(24-11-23-16)25-15-5-4-13(22)9-18(15)30-17-6-7-29-21(17)27/h4-5,8-11,17H,2,6-7H2,1,3H3,(H,26,28)(H,23,24,25) |
| InChIKey | VYLDNYPMPUYTFH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|