C17H17FN4O2S — CID 123276195
5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenol (PubChem CID 123276195) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenol.
| Compound Name | 5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 123276195 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-fluoro-2-[[5-methyl-7-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]quinazolin-4-yl]amino]phenol |
| SMILES | C=S(C)(=O)Nc1cc(C)c2c(Nc3ccc(F)cc3O)ncnc2c1 |
| InChI | InChI=1S/C17H17FN4O2S/c1-10-6-12(22-25(2,3)24)8-14-16(10)17(20-9-19-14)21-13-5-4-11(18)7-15(13)23/h4-9,23H,2H2,1,3H3,(H,22,24)(H,19,20,21) |
| InChIKey | OSEGNVLBFWJUGX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|