C25H29FN4O6S — CID 123350873
5-ethoxy-4-N-[4-fluoro-2-[(3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]phenyl]-7-N-(methyl-methylidene-oxo-λ6-sulfanyl)quinazoline-4,7-diamine (PubChem CID 123350873) has the molecular formula C25H29FN4O6S and a molecular weight of 532.59 g/mol. Its IUPAC name is 5-ethoxy-4-N-[4-fluoro-2-[(3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]phenyl]-7-N-(methyl-methylidene-oxo-λ6-sulfanyl)quinazoline-4,7-diamine.
| Compound Name | 5-ethoxy-4-N-[4-fluoro-2-[(3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]phenyl]-7-N-(methyl-methylidene-oxo-λ6-sulfanyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 123350873 |
| Molecular Formula | C25H29FN4O6S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 5-ethoxy-4-N-[4-fluoro-2-[(3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]phenyl]-7-N-(methyl-methylidene-oxo-λ6-sulfanyl)quinazoline-4,7-diamine |
| SMILES | C=S(C)(=O)Nc1cc(OCC)c2c(Nc3ccc(F)cc3OC3COC4C(OC)COC34)ncnc2c1 |
| InChI | InChI=1S/C25H29FN4O6S/c1-5-33-19-10-15(30-37(3,4)31)9-17-22(19)25(28-13-27-17)29-16-7-6-14(26)8-18(16)36-21-12-35-23-20(32-2)11-34-24(21)23/h6-10,13,20-21,23-24H,3,5,11-12H2,1-2,4H3,(H,30,31)(H,27,28,29) |
| InChIKey | BCLNRSOLTBXJMF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|