C24H29FN4O3S — CID 123438691
7-N-(tert-butyl-methylidene-oxo-λ6-sulfanyl)-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methylquinazoline-4,7-diamine (PubChem CID 123438691) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is 7-N-(tert-butyl-methylidene-oxo-λ6-sulfanyl)-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methylquinazoline-4,7-diamine.
| Compound Name | 7-N-(tert-butyl-methylidene-oxo-λ6-sulfanyl)-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 123438691 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 7-N-(tert-butyl-methylidene-oxo-λ6-sulfanyl)-4-N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methylquinazoline-4,7-diamine |
| SMILES | C=S(=O)(Nc1cc(C)c2c(Nc3ccc(F)cc3OC3CCOC3)ncnc2c1)C(C)(C)C |
| InChI | InChI=1S/C24H29FN4O3S/c1-15-10-17(29-33(5,30)24(2,3)4)12-20-22(15)23(27-14-26-20)28-19-7-6-16(25)11-21(19)32-18-8-9-31-13-18/h6-7,10-12,14,18H,5,8-9,13H2,1-4H3,(H,29,30)(H,26,27,28) |
| InChIKey | CQFZITHASBJUJF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|