C26H33FN4O3 — CID 144854884
N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methyl-7-(methylideneamino)quinazolin-4-amine;formaldehyde;pentane (PubChem CID 144854884) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methyl-7-(methylideneamino)quinazolin-4-amine;formaldehyde;pentane.
| Compound Name | N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methyl-7-(methylideneamino)quinazolin-4-amine;formaldehyde;pentane |
|---|---|
| PubChem CID | 144854884 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[4-fluoro-2-(oxolan-3-yloxy)phenyl]-5-methyl-7-(methylideneamino)quinazolin-4-amine;formaldehyde;pentane |
| SMILES | C=Nc1cc(C)c2c(Nc3ccc(F)cc3OC3CCOC3)ncnc2c1.C=O.CCCCC |
| InChI | InChI=1S/C20H19FN4O2.C5H12.CH2O/c1-12-7-14(22-2)9-17-19(12)20(24-11-23-17)25-16-4-3-13(21)8-18(16)27-15-5-6-26-10-15;1-3-5-4-2;1-2/h3-4,7-9,11,15H,2,5-6,10H2,1H3,(H,23,24,25);3-5H2,1-2H3;1H2 |
| InChIKey | MSKBFJVDJULDCA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|