C20H16F7N5O2 — CID 144764652
2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide (PubChem CID 144764652) has the molecular formula C20H16F7N5O2 and a molecular weight of 491.37 g/mol. Its IUPAC name is 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide.
| Compound Name | 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide |
|---|---|
| PubChem CID | 144764652 |
| Molecular Formula | C20H16F7N5O2 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[2-[(7-amino-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide |
| SMILES | Cc1cc(N)cc2ncnc(Nc3ccc(F)cc3OCC(=O)NC(C(F)(F)F)C(F)(F)F)c12 |
| InChI | InChI=1S/C20H16F7N5O2/c1-9-4-11(28)6-13-16(9)17(30-8-29-13)31-12-3-2-10(21)5-14(12)34-7-15(33)32-18(19(22,23)24)20(25,26)27/h2-6,8,18H,7,28H2,1H3,(H,32,33)(H,29,30,31) |
| InChIKey | BPHIDUWJVATAGJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|