C18H18FN5O3 — CID 139397318
2-[2-[(7-amino-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]acetamide (PubChem CID 139397318) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[2-[(7-amino-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]acetamide.
| Compound Name | 2-[2-[(7-amino-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]acetamide |
|---|---|
| PubChem CID | 139397318 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[2-[(7-amino-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenoxy]acetamide |
| SMILES | COc1c(N)cc2ncnc(Nc3ccc(F)cc3OCC(N)=O)c2c1C |
| InChI | InChI=1S/C18H18FN5O3/c1-9-16-13(6-11(20)17(9)26-2)22-8-23-18(16)24-12-4-3-10(19)5-14(12)27-7-15(21)25/h3-6,8H,7,20H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | QIQNBLNMUGNKAT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|