C16H13BrFN3O2 — CID 118498229
2-[(7-bromo-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenol (PubChem CID 118498229) has the molecular formula C16H13BrFN3O2 and a molecular weight of 378.20 g/mol. Its IUPAC name is 2-[(7-bromo-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenol.
| Compound Name | 2-[(7-bromo-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenol |
|---|---|
| PubChem CID | 118498229 |
| Molecular Formula | C16H13BrFN3O2 |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-[(7-bromo-6-methoxy-5-methylquinazolin-4-yl)amino]-5-fluorophenol |
| SMILES | COc1c(Br)cc2ncnc(Nc3ccc(F)cc3O)c2c1C |
| InChI | InChI=1S/C16H13BrFN3O2/c1-8-14-12(6-10(17)15(8)23-2)19-7-20-16(14)21-11-4-3-9(18)5-13(11)22/h3-7,22H,1-2H3,(H,19,20,21) |
| InChIKey | KAFRALIXRCFMBV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|