C21H24N4O3S — CID 118508657
2-[[6-methoxy-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-yl]amino]-5-methylphenol (PubChem CID 118508657) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-[[6-methoxy-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-yl]amino]-5-methylphenol.
| Compound Name | 2-[[6-methoxy-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-yl]amino]-5-methylphenol |
|---|---|
| PubChem CID | 118508657 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[[6-methoxy-5-methyl-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-yl]amino]-5-methylphenol |
| SMILES | COc1c(N=S2(=O)CCCC2)cc2ncnc(Nc3ccc(C)cc3O)c2c1C |
| InChI | InChI=1S/C21H24N4O3S/c1-13-6-7-15(18(26)10-13)24-21-19-14(2)20(28-3)17(11-16(19)22-12-23-21)25-29(27)8-4-5-9-29/h6-7,10-12,26H,4-5,8-9H2,1-3H3,(H,22,23,24) |
| InChIKey | MPMAHTJGBYPWPO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|