C25H26ClFN4O5S — CID 118508850
N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine (PubChem CID 118508850) has the molecular formula C25H26ClFN4O5S and a molecular weight of 549.02 g/mol. Its IUPAC name is N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
|---|---|
| PubChem CID | 118508850 |
| Molecular Formula | C25H26ClFN4O5S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
| SMILES | COc1c(N=S2(=O)CCCC2)cc2ncnc(Nc3ccc(F)cc3O[C@@H]3CO[C@@H]4CCO[C@@H]43)c2c1Cl |
| InChI | InChI=1S/C25H26ClFN4O5S/c1-33-23-17(31-37(32)8-2-3-9-37)11-16-21(22(23)26)25(29-13-28-16)30-15-5-4-14(27)10-19(15)36-20-12-35-18-6-7-34-24(18)20/h4-5,10-11,13,18,20,24H,2-3,6-9,12H2,1H3,(H,28,29,30)/t18-,20-,24+/m1/s1 |
| InChIKey | RTAKYUXICKDOSP-FPGHNAPASA-N |
| XLogP | 5.00 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |