C25H26ClFN4O4S — CID 139397210
N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-(thiolan-1-ylideneamino)quinazolin-4-amine (PubChem CID 139397210) has the molecular formula C25H26ClFN4O4S and a molecular weight of 533.03 g/mol. Its IUPAC name is N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-(thiolan-1-ylideneamino)quinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-(thiolan-1-ylideneamino)quinazolin-4-amine |
|---|---|
| PubChem CID | 139397210 |
| Molecular Formula | C25H26ClFN4O4S |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-6-methoxy-7-(thiolan-1-ylideneamino)quinazolin-4-amine |
| SMILES | COc1c(N=S2CCCC2)cc2ncnc(Nc3ccc(F)cc3OC3CO[C@@H]4CCO[C@H]34)c2c1Cl |
| InChI | InChI=1S/C25H26ClFN4O4S/c1-32-23-17(31-36-8-2-3-9-36)11-16-21(22(23)26)25(29-13-28-16)30-15-5-4-14(27)10-19(15)35-20-12-34-18-6-7-33-24(18)20/h4-5,10-11,13,18,20,24H,2-3,6-9,12H2,1H3,(H,28,29,30)/t18-,20?,24+/m1/s1 |
| InChIKey | SNJIFOFHIJQVFR-NMCUHEFASA-N |
| XLogP | 5.34 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |