C25H27FN4O4S — CID 129116590
N-[2-[[(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-7-[(3-methoxythietan-1-ylidene)amino]-5-methylquinazolin-4-amine (PubChem CID 129116590) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[2-[[(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-7-[(3-methoxythietan-1-ylidene)amino]-5-methylquinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-7-[(3-methoxythietan-1-ylidene)amino]-5-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 129116590 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[2-[[(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-7-[(3-methoxythietan-1-ylidene)amino]-5-methylquinazolin-4-amine |
| SMILES | COC1CS(=Nc2cc(C)c3c(Nc4ccc(F)cc4O[C@@H]4CO[C@@H]5CCOC54)ncnc3c2)C1 |
| InChI | InChI=1S/C25H27FN4O4S/c1-14-7-16(30-35-11-17(12-35)31-2)9-19-23(14)25(28-13-27-19)29-18-4-3-15(26)8-21(18)34-22-10-33-20-5-6-32-24(20)22/h3-4,7-9,13,17,20,22,24H,5-6,10-12H2,1-2H3,(H,27,28,29)/t17?,20-,22-,24?,35?/m1/s1 |
| InChIKey | JGDUEANJSGOYEN-BJFSSZKLSA-N |
| XLogP | 4.22 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |