C24H24ClFN4O4S — CID 75201808
N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine (PubChem CID 75201808) has the molecular formula C24H24ClFN4O4S and a molecular weight of 519.00 g/mol. Its IUPAC name is N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine.
| Compound Name | N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
|---|---|
| PubChem CID | 75201808 |
| Molecular Formula | C24H24ClFN4O4S |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[2-[[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-chloro-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
| SMILES | O=S1(=Nc2cc(Cl)c3c(Nc4ccc(F)cc4O[C@@H]4CO[C@@H]5CCO[C@@H]54)ncnc3c2)CCCC1 |
| InChI | InChI=1S/C24H24ClFN4O4S/c25-16-10-15(30-35(31)7-1-2-8-35)11-18-22(16)24(28-13-27-18)29-17-4-3-14(26)9-20(17)34-21-12-33-19-5-6-32-23(19)21/h3-4,9-11,13,19,21,23H,1-2,5-8,12H2,(H,27,28,29)/t19-,21-,23+/m1/s1 |
| InChIKey | CRPBEDUGXTXMDA-LSWJPFSZSA-N |
| XLogP | 4.99 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |