C21H25F2N5OS — CID 144622867
4-N-[2-(4,4-difluorocyclohexyl)oxy-3-pyridinyl]-5-methylquinazoline-4,7-diamine;methanethiol (PubChem CID 144622867) has the molecular formula C21H25F2N5OS and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-N-[2-(4,4-difluorocyclohexyl)oxy-3-pyridinyl]-5-methylquinazoline-4,7-diamine;methanethiol.
| Compound Name | 4-N-[2-(4,4-difluorocyclohexyl)oxy-3-pyridinyl]-5-methylquinazoline-4,7-diamine;methanethiol |
|---|---|
| PubChem CID | 144622867 |
| Molecular Formula | C21H25F2N5OS |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-N-[2-(4,4-difluorocyclohexyl)oxy-3-pyridinyl]-5-methylquinazoline-4,7-diamine;methanethiol |
| SMILES | CS.Cc1cc(N)cc2ncnc(Nc3cccnc3OC3CCC(F)(F)CC3)c12 |
| InChI | InChI=1S/C20H21F2N5O.CH4S/c1-12-9-13(23)10-16-17(12)18(26-11-25-16)27-15-3-2-8-24-19(15)28-14-4-6-20(21,22)7-5-14;1-2/h2-3,8-11,14H,4-7,23H2,1H3,(H,25,26,27);2H,1H3 |
| InChIKey | APGRWTJYYLORTO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|