C13H11F4NO8S — CID 86718458
[(3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate (PubChem CID 86718458) has the molecular formula C13H11F4NO8S and a molecular weight of 417.29 g/mol. Its IUPAC name is [(3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86718458 |
| Molecular Formula | C13H11F4NO8S |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | [(3R,3aR,6R,6aS)-3-(5-fluoro-2-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1ccc(F)cc1O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F4NO8S/c14-6-1-2-7(18(19)20)8(3-6)25-9-4-23-12-10(5-24-11(9)12)26-27(21,22)13(15,16)17/h1-3,9-12H,4-5H2/t9-,10-,11-,12-/m1/s1 |
| InChIKey | XIPUQRHVCCKYAO-DDHJBXDOSA-N |
| XLogP | 1.51 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|