C12H11F3N2O8S — CID 118498476
[(3R,3aR,6R,6aS)-3-[(3-nitro-2-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate (PubChem CID 118498476) has the molecular formula C12H11F3N2O8S and a molecular weight of 400.29 g/mol. Its IUPAC name is [(3R,3aR,6R,6aS)-3-[(3-nitro-2-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,3aR,6R,6aS)-3-[(3-nitro-2-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118498476 |
| Molecular Formula | C12H11F3N2O8S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [(3R,3aR,6R,6aS)-3-[(3-nitro-2-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1cccnc1O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O8S/c13-12(14,15)26(20,21)25-8-5-23-9-7(4-22-10(8)9)24-11-6(17(18)19)2-1-3-16-11/h1-3,7-10H,4-5H2/t7-,8-,9-,10-/m1/s1 |
| InChIKey | ITPFIMBAYMDLJU-ZYUZMQFOSA-N |
| XLogP | 0.77 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|