C12H16N2O4 — CID 58421668
2-[(1R,3S)-3-methoxycyclohexyl]oxy-3-nitropyridine (PubChem CID 58421668) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(1R,3S)-3-methoxycyclohexyl]oxy-3-nitropyridine.
| Compound Name | 2-[(1R,3S)-3-methoxycyclohexyl]oxy-3-nitropyridine |
|---|---|
| PubChem CID | 58421668 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[(1R,3S)-3-methoxycyclohexyl]oxy-3-nitropyridine |
| SMILES | CO[C@H]1CCC[C@@H](Oc2ncccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H16N2O4/c1-17-9-4-2-5-10(8-9)18-12-11(14(15)16)6-3-7-13-12/h3,6-7,9-10H,2,4-5,8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | KNZOPDKYMFZDNS-VHSXEESVSA-N |
| XLogP | 2.33 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|