C10H12N2O7 — CID 10858605
(2S,3R,4S,5R)-2-[(3-nitro-2-pyridinyl)oxy]oxane-3,4,5-triol (PubChem CID 10858605) has the molecular formula C10H12N2O7 and a molecular weight of 272.21 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(3-nitro-2-pyridinyl)oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(3-nitro-2-pyridinyl)oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10858605 |
| Molecular Formula | C10H12N2O7 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(3-nitro-2-pyridinyl)oxy]oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cccnc1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N2O7/c13-6-4-18-10(8(15)7(6)14)19-9-5(12(16)17)2-1-3-11-9/h1-3,6-8,10,13-15H,4H2/t6-,7+,8-,10+/m1/s1 |
| InChIKey | KOZQGHGECHADQY-JIOCBJNQSA-N |
| XLogP | -1.19 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|