About (3-nitro-2-pyridinyl) trifluoromethanesulfonate
(3-nitro-2-pyridinyl) trifluoromethanesulfonate (PubChem CID 3252111) has the molecular formula C6H3F3N2O5S
and a molecular weight of 272.16 g/mol. Its IUPAC name is (3-nitro-2-pyridinyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-nitro-2-pyridinyl) trifluoromethanesulfonate |
| PubChem CID | 3252111 |
| Molecular Formula | C6H3F3N2O5S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (3-nitro-2-pyridinyl) trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1cccnc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H3F3N2O5S/c7-6(8,9)17(14,15)16-5-4(11(12)13)2-1-3-10-5/h1-3H |
| InChIKey | BZTKUWFNUZSRKT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-nitro-2-pyridinyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitro-2-pyridinyl) trifluoromethanesulfonate?
The IUPAC name of (3-nitro-2-pyridinyl) trifluoromethanesulfonate (CID 3252111) is (3-nitro-2-pyridinyl) trifluoromethanesulfonate.
What is the SMILES notation for (3-nitro-2-pyridinyl) trifluoromethanesulfonate?
The canonical SMILES for (3-nitro-2-pyridinyl) trifluoromethanesulfonate is O=[N+]([O-])c1cccnc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (3-nitro-2-pyridinyl) trifluoromethanesulfonate?
The InChIKey is BZTKUWFNUZSRKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N2O5S/c7-6(8,9)17(14,15)16-5-4(11(12)13)2-1-3-10-5/h1-3H.
What are the key properties of (3-nitro-2-pyridinyl) trifluoromethanesulfonate?
(3-nitro-2-pyridinyl) trifluoromethanesulfonate has a molecular weight of 272.16 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitro-2-pyridinyl) trifluoromethanesulfonate is sourced from PubChem (CID 3252111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).