C10H12N2O5 — CID 129256660
2-[(3R,4S)-4-methoxyoxolan-3-yl]oxy-3-nitropyridine (PubChem CID 129256660) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-[(3R,4S)-4-methoxyoxolan-3-yl]oxy-3-nitropyridine.
| Compound Name | 2-[(3R,4S)-4-methoxyoxolan-3-yl]oxy-3-nitropyridine |
|---|---|
| PubChem CID | 129256660 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-[(3R,4S)-4-methoxyoxolan-3-yl]oxy-3-nitropyridine |
| SMILES | CO[C@H]1COC[C@H]1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O5/c1-15-8-5-16-6-9(8)17-10-7(12(13)14)3-2-4-11-10/h2-4,8-9H,5-6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | KXXXJJKGWPXLRA-DTWKUNHWSA-N |
| XLogP | 0.78 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|