C18H18N2O7S — CID 155236205
[(3S,6S)-3-(2-methylsulfonylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate (PubChem CID 155236205) has the molecular formula C18H18N2O7S and a molecular weight of 406.42 g/mol. Its IUPAC name is [(3S,6S)-3-(2-methylsulfonylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate.
| Compound Name | [(3S,6S)-3-(2-methylsulfonylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate |
|---|---|
| PubChem CID | 155236205 |
| Molecular Formula | C18H18N2O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [(3S,6S)-3-(2-methylsulfonylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate |
| SMILES | CS(=O)(=O)c1nccc(O[C@H]2COC3C2OC[C@@H]3OC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N2O7S/c1-28(22,23)18-19-8-7-14(20-18)26-12-9-24-16-13(10-25-15(12)16)27-17(21)11-5-3-2-4-6-11/h2-8,12-13,15-16H,9-10H2,1H3/t12-,13-,15?,16?/m0/s1 |
| InChIKey | ZYZAWZZCUILSCV-VRLRAXNCSA-N |
| XLogP | 0.65 |
| TPSA | 113.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |