C18H18N2O5S — CID 126652333
[(3aR,6S,6aR)-3-(2-methylsulfanylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate (PubChem CID 126652333) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [(3aR,6S,6aR)-3-(2-methylsulfanylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate.
| Compound Name | [(3aR,6S,6aR)-3-(2-methylsulfanylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate |
|---|---|
| PubChem CID | 126652333 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(3aR,6S,6aR)-3-(2-methylsulfanylpyrimidin-4-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] benzoate |
| SMILES | CSc1nccc(OC2CO[C@@H]3[C@@H](OC(=O)c4ccccc4)CO[C@H]23)n1 |
| InChI | InChI=1S/C18H18N2O5S/c1-26-18-19-8-7-14(20-18)24-12-9-22-16-13(10-23-15(12)16)25-17(21)11-5-3-2-4-6-11/h2-8,12-13,15-16H,9-10H2,1H3/t12?,13-,15+,16+/m0/s1 |
| InChIKey | OAFFWGCGCWWUMT-CCQOOCRRSA-N |
| XLogP | 1.97 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |