About 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine
4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine (PubChem CID 168867290) has the molecular formula C9H11FN2O4S
and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine.
Molecular Properties
| Compound Name | 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine |
| PubChem CID | 168867290 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine |
| SMILES | CS(=O)(=O)c1nccc(O[C@H]2COC[C@H]2F)n1 |
| InChI | InChI=1S/C9H11FN2O4S/c1-17(13,14)9-11-3-2-8(12-9)16-7-5-15-4-6(7)10/h2-3,6-7H,4-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | PAEQEDVOQIOBBT-RQJHMYQMSA-N |
| XLogP | -0.00 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine?
The IUPAC name of 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine (CID 168867290) is 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine.
What is the SMILES notation for 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine?
The canonical SMILES for 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine is CS(=O)(=O)c1nccc(O[C@H]2COC[C@H]2F)n1.
What is the InChIKey of 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine?
The InChIKey is PAEQEDVOQIOBBT-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H11FN2O4S/c1-17(13,14)9-11-3-2-8(12-9)16-7-5-15-4-6(7)10/h2-3,6-7H,4-5H2,1H3/t6-,7+/m1/s1.
What are the key properties of 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine?
4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine has a molecular weight of 262.26 g/mol, XLogP of -0.00, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine is sourced from PubChem (CID 168867290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).