C9H11FN2O4S — CID 168867290
4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine (PubChem CID 168867290) has the molecular formula C9H11FN2O4S and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine.
| Compound Name | 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine |
|---|---|
| PubChem CID | 168867290 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfonylpyrimidine |
| SMILES | CS(=O)(=O)c1nccc(O[C@H]2COC[C@H]2F)n1 |
| InChI | InChI=1S/C9H11FN2O4S/c1-17(13,14)9-11-3-2-8(12-9)16-7-5-15-4-6(7)10/h2-3,6-7H,4-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | PAEQEDVOQIOBBT-RQJHMYQMSA-N |
| XLogP | -0.00 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |