C12H18N2O4S — CID 139342597
[4-(2-methylpyrimidin-4-yl)oxycyclohexyl] methanesulfonate (PubChem CID 139342597) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is [4-(2-methylpyrimidin-4-yl)oxycyclohexyl] methanesulfonate.
| Compound Name | [4-(2-methylpyrimidin-4-yl)oxycyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 139342597 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [4-(2-methylpyrimidin-4-yl)oxycyclohexyl] methanesulfonate |
| SMILES | Cc1nccc(OC2CCC(OS(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C12H18N2O4S/c1-9-13-8-7-12(14-9)17-10-3-5-11(6-4-10)18-19(2,15)16/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | ZQAFILDAWUGAHS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|