C16H18N4O5S — CID 121162803
2-methyl-4-[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]oxypyrimidine (PubChem CID 121162803) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-methyl-4-[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]oxypyrimidine.
| Compound Name | 2-methyl-4-[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]oxypyrimidine |
|---|---|
| PubChem CID | 121162803 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-methyl-4-[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]oxypyrimidine |
| SMILES | Cc1nccc(OC2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C16H18N4O5S/c1-12-17-9-6-16(18-12)25-13-7-10-19(11-8-13)26(23,24)15-5-3-2-4-14(15)20(21)22/h2-6,9,13H,7-8,10-11H2,1H3 |
| InChIKey | PNHCWPYTADFBRO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 115.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|