About 4-methoxypyrimidine-2-sulfonic acid;hydrate
4-methoxypyrimidine-2-sulfonic acid;hydrate (PubChem CID 174301054) has the molecular formula C5H8N2O5S
and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-methoxypyrimidine-2-sulfonic acid;hydrate.
Molecular Properties
| Compound Name | 4-methoxypyrimidine-2-sulfonic acid;hydrate |
| PubChem CID | 174301054 |
| Molecular Formula | C5H8N2O5S |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 4-methoxypyrimidine-2-sulfonic acid;hydrate |
| SMILES | COc1ccnc(S(=O)(=O)O)n1.O |
| InChI | InChI=1S/C5H6N2O4S.H2O/c1-11-4-2-3-6-5(7-4)12(8,9)10;/h2-3H,1H3,(H,8,9,10);1H2 |
| InChIKey | YBCDALXBHUTQEE-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxypyrimidine-2-sulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypyrimidine-2-sulfonic acid;hydrate?
The IUPAC name of 4-methoxypyrimidine-2-sulfonic acid;hydrate (CID 174301054) is 4-methoxypyrimidine-2-sulfonic acid;hydrate.
What is the SMILES notation for 4-methoxypyrimidine-2-sulfonic acid;hydrate?
The canonical SMILES for 4-methoxypyrimidine-2-sulfonic acid;hydrate is COc1ccnc(S(=O)(=O)O)n1.O.
What is the InChIKey of 4-methoxypyrimidine-2-sulfonic acid;hydrate?
The InChIKey is YBCDALXBHUTQEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4S.H2O/c1-11-4-2-3-6-5(7-4)12(8,9)10;/h2-3H,1H3,(H,8,9,10);1H2.
What are the key properties of 4-methoxypyrimidine-2-sulfonic acid;hydrate?
4-methoxypyrimidine-2-sulfonic acid;hydrate has a molecular weight of 208.19 g/mol, XLogP of -1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypyrimidine-2-sulfonic acid;hydrate is sourced from PubChem (CID 174301054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).