C13H14N4O4S — CID 25048024
N-[4-[(4-methoxypyrimidin-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 25048024) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-[4-[(4-methoxypyrimidin-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-methoxypyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 25048024 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[4-[(4-methoxypyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccnc(NS(=O)(=O)c2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C13H14N4O4S/c1-9(18)15-10-3-5-11(6-4-10)22(19,20)17-13-14-8-7-12(16-13)21-2/h3-8H,1-2H3,(H,15,18)(H,14,16,17) |
| InChIKey | HWOOAWXFZKFENN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |