C20H17FN4O3S — CID 2901378
N-[4-[[4-[2-(2-fluorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 2901378) has the molecular formula C20H17FN4O3S and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[4-[[4-[2-(2-fluorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[2-(2-fluorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2901378 |
| Molecular Formula | C20H17FN4O3S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[4-[[4-[2-(2-fluorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nccc(C=Cc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C20H17FN4O3S/c1-14(26)23-16-8-10-18(11-9-16)29(27,28)25-20-22-13-12-17(24-20)7-6-15-4-2-3-5-19(15)21/h2-13H,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | DFHLVTUJDQUUTG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |