C19H14Cl2N4O3S — CID 55334572
(E)-3-(2,3-dichlorophenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55334572) has the molecular formula C19H14Cl2N4O3S and a molecular weight of 449.32 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55334572 |
| Molecular Formula | C19H14Cl2N4O3S |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C19H14Cl2N4O3S/c20-16-4-1-3-13(18(16)21)5-10-17(26)24-14-6-8-15(9-7-14)29(27,28)25-19-22-11-2-12-23-19/h1-12H,(H,24,26)(H,22,23,25)/b10-5+ |
| InChIKey | JEDOABZPAYABQL-BJMVGYQFSA-N |
| XLogP | 4.24 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|