C25H19ClN4O3S — CID 92913526
N-[4-[[4-[(Z)-2-(4-chlorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]benzamide (PubChem CID 92913526) has the molecular formula C25H19ClN4O3S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-[4-[[4-[(Z)-2-(4-chlorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[4-[(Z)-2-(4-chlorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 92913526 |
| Molecular Formula | C25H19ClN4O3S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[4-[[4-[(Z)-2-(4-chlorophenyl)ethenyl]pyrimidin-2-yl]sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccc(/C=C\c3ccc(Cl)cc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClN4O3S/c26-20-9-6-18(7-10-20)8-11-22-16-17-27-25(29-22)30-34(32,33)23-14-12-21(13-15-23)28-24(31)19-4-2-1-3-5-19/h1-17H,(H,28,31)(H,27,29,30)/b11-8- |
| InChIKey | DIDFAXPJFUWZLH-FLIBITNWSA-N |
| XLogP | 5.35 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |