C19H18N4O5S — CID 1084470
3,4-dimethoxy-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 1084470) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1084470 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1OC |
| InChI | InChI=1S/C19H18N4O5S/c1-27-16-9-4-13(12-17(16)28-2)18(24)22-14-5-7-15(8-6-14)29(25,26)23-19-20-10-3-11-21-19/h3-12H,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | LGTUPYFYRDTLTR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |