C48H25F12O4P — CID 46176937
10,16-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 46176937) has the molecular formula C48H25F12O4P and a molecular weight of 924.67 g/mol. Its IUPAC name is 10,16-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 10,16-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 46176937 |
| Molecular Formula | C48H25F12O4P |
| Molecular Weight | 924.67 g/mol |
| Exact Mass | 924.13 |
| IUPAC Name | 10,16-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | O=P1(O)Oc2c(-c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc3ccccc3c2-c2c(c(-c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc3ccccc23)O1 |
| InChI | InChI=1S/C48H25F12O4P/c49-45(50,51)33-17-31(18-34(23-33)46(52,53)54)25-9-13-27(14-10-25)39-21-29-5-1-3-7-37(29)41-42-38-8-4-2-6-30(38)22-40(44(42)64-65(61,62)63-43(39)41)28-15-11-26(12-16-28)32-19-35(47(55,56)57)24-36(20-32)48(58,59)60/h1-24H,(H,61,62) |
| InChIKey | JLQGZDZCPWGOKZ-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.67 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|