C46H33O6P — CID 135019951
[13-hydroxy-16-[hydroxy(diphenyl)methyl]-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-diphenylmethanol (PubChem CID 135019951) has the molecular formula C46H33O6P and a molecular weight of 712.74 g/mol. Its IUPAC name is [13-hydroxy-16-[hydroxy(diphenyl)methyl]-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-diphenylmethanol.
| Compound Name | [13-hydroxy-16-[hydroxy(diphenyl)methyl]-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 135019951 |
| Molecular Formula | C46H33O6P |
| Molecular Weight | 712.74 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | [13-hydroxy-16-[hydroxy(diphenyl)methyl]-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-diphenylmethanol |
| SMILES | O=P1(O)Oc2c(C(O)(c3ccccc3)c3ccccc3)cc3ccccc3c2-c2c(c(C(O)(c3ccccc3)c3ccccc3)cc3ccccc23)O1 |
| InChI | InChI=1S/C46H33O6P/c47-45(33-19-5-1-6-20-33,34-21-7-2-8-22-34)39-29-31-17-13-15-27-37(31)41-42-38-28-16-14-18-32(38)30-40(44(42)52-53(49,50)51-43(39)41)46(48,35-23-9-3-10-24-35)36-25-11-4-12-26-36/h1-30,47-48H,(H,49,50) |
| InChIKey | RBZUKWJDYDRNEE-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.74 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|