C38H33O6P — CID 155009246
10,16-bis(2-ethoxy-5-methylphenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 155009246) has the molecular formula C38H33O6P and a molecular weight of 616.65 g/mol. Its IUPAC name is 10,16-bis(2-ethoxy-5-methylphenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 10,16-bis(2-ethoxy-5-methylphenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 155009246 |
| Molecular Formula | C38H33O6P |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 10,16-bis(2-ethoxy-5-methylphenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | CCOc1ccc(C)cc1-c1cc2ccccc2c2c1OP(=O)(O)Oc1c(-c3cc(C)ccc3OCC)cc3ccccc3c1-2 |
| InChI | InChI=1S/C38H33O6P/c1-5-41-33-17-15-23(3)19-29(33)31-21-25-11-7-9-13-27(25)35-36-28-14-10-8-12-26(28)22-32(38(36)44-45(39,40)43-37(31)35)30-20-24(4)16-18-34(30)42-6-2/h7-22H,5-6H2,1-4H3,(H,39,40) |
| InChIKey | XGRAVBRZQDLDIO-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|