C17H15NO3 — CID 9320225
2-(2-ethoxyphenyl)-6-methyl-3,1-benzoxazin-4-one (PubChem CID 9320225) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-6-methyl-3,1-benzoxazin-4-one.
| Compound Name | 2-(2-ethoxyphenyl)-6-methyl-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 9320225 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(2-ethoxyphenyl)-6-methyl-3,1-benzoxazin-4-one |
| SMILES | CCOc1ccccc1-c1nc2ccc(C)cc2c(=O)o1 |
| InChI | InChI=1S/C17H15NO3/c1-3-20-15-7-5-4-6-12(15)16-18-14-9-8-11(2)10-13(14)17(19)21-16/h4-10H,3H2,1-2H3 |
| InChIKey | CZDVIBFKJVSODC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |