C34H23Br2O6P — CID 66646516
6,20-dibromo-13-hydroxy-5,21-bis(phenylmethoxy)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 66646516) has the molecular formula C34H23Br2O6P and a molecular weight of 718.33 g/mol. Its IUPAC name is 6,20-dibromo-13-hydroxy-5,21-bis(phenylmethoxy)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 6,20-dibromo-13-hydroxy-5,21-bis(phenylmethoxy)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 66646516 |
| Molecular Formula | C34H23Br2O6P |
| Molecular Weight | 718.33 g/mol |
| Exact Mass | 715.96 |
| IUPAC Name | 6,20-dibromo-13-hydroxy-5,21-bis(phenylmethoxy)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | O=P1(O)Oc2ccc3cc(Br)c(OCc4ccccc4)cc3c2-c2c(ccc3cc(Br)c(OCc4ccccc4)cc23)O1 |
| InChI | InChI=1S/C34H23Br2O6P/c35-27-15-23-11-13-29-33(25(23)17-31(27)39-19-21-7-3-1-4-8-21)34-26-18-32(40-20-22-9-5-2-6-10-22)28(36)16-24(26)12-14-30(34)42-43(37,38)41-29/h1-18H,19-20H2,(H,37,38) |
| InChIKey | CYVYHYLSWYDSQN-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.33 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|