C29H29O3PSe — CID 101459052
13-[(1R,2S)-2-propan-2-ylcyclohexyl]oxy-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 101459052) has the molecular formula C29H29O3PSe and a molecular weight of 535.48 g/mol. Its IUPAC name is 13-[(1R,2S)-2-propan-2-ylcyclohexyl]oxy-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-[(1R,2S)-2-propan-2-ylcyclohexyl]oxy-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 101459052 |
| Molecular Formula | C29H29O3PSe |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 13-[(1R,2S)-2-propan-2-ylcyclohexyl]oxy-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CC(C)[C@@H]1CCCC[C@H]1OP1(=[Se])Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C29H29O3PSe/c1-19(2)22-11-7-8-14-25(22)30-33(34)31-26-17-15-20-9-3-5-12-23(20)28(26)29-24-13-6-4-10-21(24)16-18-27(29)32-33/h3-6,9-10,12-13,15-19,22,25H,7-8,11,14H2,1-2H3/t22-,25+/m0/s1 |
| InChIKey | LMWQWDCOQYGTOK-WIOPSUGQSA-N |
| XLogP | 8.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|