C23H19O4PSe — CID 102333568
1-[(13-selenido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)oxy]propan-2-ol (PubChem CID 102333568) has the molecular formula C23H19O4PSe and a molecular weight of 469.34 g/mol. Its IUPAC name is 1-[(13-selenido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)oxy]propan-2-ol.
| Compound Name | 1-[(13-selenido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 102333568 |
| Molecular Formula | C23H19O4PSe |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 1-[(13-selenido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)oxy]propan-2-ol |
| SMILES | CC(O)CO[P+]1([Se-])Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C23H19O4PSe/c1-15(24)14-25-28(29)26-20-12-10-16-6-2-4-8-18(16)22(20)23-19-9-5-3-7-17(19)11-13-21(23)27-28/h2-13,15,24H,14H2,1H3 |
| InChIKey | ZHZNGSDBJQPGCA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|