C32H25O4PS — CID 102589798
3-[(S)-(4-methoxyphenyl)-(13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)methyl]but-3-en-2-one (PubChem CID 102589798) has the molecular formula C32H25O4PS and a molecular weight of 536.59 g/mol. Its IUPAC name is 3-[(S)-(4-methoxyphenyl)-(13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)methyl]but-3-en-2-one.
| Compound Name | 3-[(S)-(4-methoxyphenyl)-(13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 102589798 |
| Molecular Formula | C32H25O4PS |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 3-[(S)-(4-methoxyphenyl)-(13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)methyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)[C@H](c1ccc(OC)cc1)[P+]1([S-])Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C32H25O4PS/c1-20(21(2)33)32(24-12-16-25(34-3)17-13-24)37(38)35-28-18-14-22-8-4-6-10-26(22)30(28)31-27-11-7-5-9-23(27)15-19-29(31)36-37/h4-19,32H,1H2,2-3H3/t32-/m1/s1 |
| InChIKey | SYEOWENVPNLHRJ-JGCGQSQUSA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|