C21H15GaO2 — CID 134906119
13-methyl-12,14-dioxa-13-gallapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 134906119) has the molecular formula C21H15GaO2 and a molecular weight of 369.07 g/mol. Its IUPAC name is 13-methyl-12,14-dioxa-13-gallapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-methyl-12,14-dioxa-13-gallapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 134906119 |
| Molecular Formula | C21H15GaO2 |
| Molecular Weight | 369.07 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 13-methyl-12,14-dioxa-13-gallapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | C[Ga]1Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C20H14O2.CH3.Ga/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;;/h1-12,21-22H;1H3;/q;;+2/p-2 |
| InChIKey | YBMFHWLZERKXNA-UHFFFAOYSA-L |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.07 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |