C22H18AlLiO3 — CID 70420201
lithium;13-ethoxy-12,14-dioxa-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene;hydride (PubChem CID 70420201) has the molecular formula C22H18AlLiO3 and a molecular weight of 364.31 g/mol. Its IUPAC name is lithium;13-ethoxy-12,14-dioxa-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene;hydride.
| Compound Name | lithium;13-ethoxy-12,14-dioxa-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene;hydride |
|---|---|
| PubChem CID | 70420201 |
| Molecular Formula | C22H18AlLiO3 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | lithium;13-ethoxy-12,14-dioxa-13-aluminapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene;hydride |
| SMILES | CCO[Al]1Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1.[H-].[Li+] |
| InChI | InChI=1S/C20H14O2.C2H5O.Al.Li.H/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-2-3;;;/h1-12,21-22H;2H2,1H3;;;/q;-1;+3;+1;-1/p-2 |
| InChIKey | OZIJZLBRXOXIMZ-UHFFFAOYSA-L |
| XLogP | 2.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |